cas: 195385-93-4 — see every product listed under this CAS number, including other names
7-(((2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)oxy)-4-methyl-2H-chromen-2-one, 98% (CAS 195385-93-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727627-50MG |
| cas | 195385-93-4 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1289.15 Pln | |
| Fluorochem | 100mg | 2221.11 Pln | |
| Fluorochem | 250mg | 4829.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-methylchromen-2-one (CAS 195385-93-4) is a chemical compound with the molecular formula C15H16O7 and a molecular weight of 308.28 g/mol. IUPAC name: 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-methylchromen-2-one. InChIKey: FAGLTVBWEMHJRP-NMFUWQPSSA-N.
| Molecular formula | C15H16O7 |
|---|---|
| Molecular weight | 308.28 g/mol |
| IUPAC name | 7-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-4-methylchromen-2-one |
| InChIKey | FAGLTVBWEMHJRP-NMFUWQPSSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)