Products 297132-04-8

CAS 297132-04-8 is the registry number for 4-(((4-(Acryloyloxy)butoxy)carbonyl)oxy)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid (CAS 297132-04-8) is a chemical compound with the molecular formula C15H16O7 and a molecular weight of 308.28 g/mol. IUPAC name: 4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid. InChIKey: UZGCTULFQVGVNS-UHFFFAOYSA-N.

Identity
Molecular formulaC15H16O7
Molecular weight308.28 g/mol
IUPAC name4-(4-prop-2-enoyloxybutoxycarbonyloxy)benzoic acid
InChIKeyUZGCTULFQVGVNS-UHFFFAOYSA-N
SMILESC=CC(=O)OCCCCOC(=O)OC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)