cas: 23146-06-7 — see every product listed under this CAS number, including other names
7-(3-Bromopropyl)-1,3-dimethyl-2,3,6,7-tetrahydro-1h-purine-2,6-dione, 98%, 98% (CAS 23146-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113MDG-100mg |
| cas | 23146-06-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 822.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione (CAS 23146-06-7) is a chemical compound with the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. IUPAC name: 7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione. InChIKey: IXYPCFPAFIVIGP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN4O2 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | IXYPCFPAFIVIGP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCBr |
Computed by PubChem (NCBI)