7-(3-Bromopropyl)-1,3-dimethyl-2,3,6,7-tetrahydro-1h-purine-2,6-dione, 98%
cas: 23146-06-7 — see every product listed under this CAS number, including other names
7-(3-Bromopropyl)-1,3-dimethyl-2,3,6,7-tetrahydro-1h-purine-2,6-dione, 98% (CAS 23146-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F640752-100MG |
| cas | 23146-06-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 500mg | 726.85 Pln | |
| Fluorochem | 1g | 914.28 Pln | |
| Fluorochem | 2.5g | 2200.28 Pln | |
| Fluorochem | 5g | 4345.36 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione (CAS 23146-06-7) is a chemical compound with the molecular formula C10H13BrN4O2 and a molecular weight of 301.14 g/mol. IUPAC name: 7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione. InChIKey: IXYPCFPAFIVIGP-UHFFFAOYSA-N.
| Molecular formula | C10H13BrN4O2 |
|---|---|
| Molecular weight | 301.14 g/mol |
| IUPAC name | 7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione |
| InChIKey | IXYPCFPAFIVIGP-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCBr |
Computed by PubChem (NCBI)
Synonyms:
7-(3-Bromopropyl)-3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, 7-(3-bromopropyl)-1,3-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione, 7-(3-bromopropyl)-1,3-dimethylpurine-2,6-dione, 7-(3-Bromopropyl)theophylline, 1H-Purine-2,6-dione, 7-(3-bromopropyl)-3,7-dihydro-1,3-dimethyl-, 7-(3-bromopropyl)-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione, Theophylline, 7-(3-bromopropyl)-, 3-(theophyllin-7-yl)propyl bromide, 7-(3-bromopropyl)-1,3-dimethyl-purine-2,6-dione