7-(3-Hexylphenyl)heptanoic acid, 95%
cas: 945414-26-6 — see every product listed under this CAS number, including other names
7-(3-Hexylphenyl)heptanoic acid, 95% (CAS 945414-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A2887782-100mg |
| cas | 945414-26-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2517.50 Pln | |
| Ambeed | 250mg | 4970.56 Pln | |
| Ambeed | 1g | 15756.25 Pln | |
| BLDpharm | 25mg | 808.63 Pln | |
| BLDpharm | 50mg | 1463.95 Pln | |
| BLDpharm | 100mg | 2713.51 Pln | |
| BLDpharm | 250mg | 5351.47 Pln | |
| BLDpharm | 1g | 16980.71 Pln | |
| Chemat | 25mg | 549.20 Pln | |
| Chemat | 50mg | 990.80 Pln | |
| Chemat | 100mg | 1826.00 Pln | |
| Chemat | 250mg | 3587.60 Pln | |
| Fluorochem | 100mg | 2590.77 Pln | |
| Fluorochem | 250mg | 5084.69 Pln | |
| Fluorochem | 1g | 15830.90 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
7-(3-hexylphenyl)heptanoic acid (CAS 945414-26-6) is a chemical compound with the molecular formula C19H30O2 and a molecular weight of 290.4 g/mol. IUPAC name: 7-(3-hexylphenyl)heptanoic acid. InChIKey: FPUOYDRZJYIBBR-UHFFFAOYSA-N.
| Molecular formula | C19H30O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 7-(3-hexylphenyl)heptanoic acid |
| InChIKey | FPUOYDRZJYIBBR-UHFFFAOYSA-N |
| SMILES | CCCCCCC1=CC(=CC=C1)CCCCCCC(=O)O |
Computed by PubChem (NCBI)