CAS 66415-27-8 is the registry number for 2,4,6-Tri-tert-butylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-tritert-butylbenzoic acid (CAS 66415-27-8) is a chemical compound with the molecular formula C19H30O2 and a molecular weight of 290.4 g/mol. IUPAC name: 2,4,6-tritert-butylbenzoic acid. InChIKey: CAVNOUJHOZKWHP-UHFFFAOYSA-N.
| Molecular formula | C19H30O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | 2,4,6-tritert-butylbenzoic acid |
| InChIKey | CAVNOUJHOZKWHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)