Products 66415-27-8

CAS 66415-27-8 is the registry number for 2,4,6-Tri-tert-butylbenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,4,6-tritert-butylbenzoic acid (CAS 66415-27-8) is a chemical compound with the molecular formula C19H30O2 and a molecular weight of 290.4 g/mol. IUPAC name: 2,4,6-tritert-butylbenzoic acid. InChIKey: CAVNOUJHOZKWHP-UHFFFAOYSA-N.

Identity
Molecular formulaC19H30O2
Molecular weight290.4 g/mol
IUPAC name2,4,6-tritert-butylbenzoic acid
InChIKeyCAVNOUJHOZKWHP-UHFFFAOYSA-N
SMILESCC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)C(=O)O)C(C)(C)C

Computed by PubChem (NCBI)