7-(7-Aminoheptanamido)heptanoic acid, 95%
cas: 1308300-37-9 — see every product listed under this CAS number, including other names
7-(7-Aminoheptanamido)heptanoic acid, 95% (CAS 1308300-37-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1020747-100mg |
| cas | 1308300-37-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 998.94 Pln | |
| Ambeed | 250mg | 1655.31 Pln | |
| Ambeed | 1g | 4336.44 Pln | |
| BLDpharm | 100mg | 980.79 Pln | |
| BLDpharm | 250mg | 1625.01 Pln | |
| BLDpharm | 1g | 4251.86 Pln | |
| Chemat | 100mg | 832.40 Pln | |
| Chemat | 250mg | 1523.60 Pln | |
| Chemat | 1g | 4010.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
7-(7-aminoheptanoylamino)heptanoic acid (CAS 1308300-37-9) is a chemical compound with the molecular formula C14H28N2O3 and a molecular weight of 272.38 g/mol. IUPAC name: 7-(7-aminoheptanoylamino)heptanoic acid. InChIKey: SNEUQJCNIMVODV-UHFFFAOYSA-N.
| Molecular formula | C14H28N2O3 |
|---|---|
| Molecular weight | 272.38 g/mol |
| IUPAC name | 7-(7-aminoheptanoylamino)heptanoic acid |
| InChIKey | SNEUQJCNIMVODV-UHFFFAOYSA-N |
| SMILES | C(CCCN)CCC(=O)NCCCCCCC(=O)O |
Computed by PubChem (NCBI)