Products 132393-08-9
CAS 132393-08-9 is the registry number for tert-Butyl (S)-(1-(diethylamino)-3-methyl-1-oxobutan-2-yl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2S)-1-(diethylamino)-3-methyl-1-oxobutan-2-yl]carbamate (CAS 132393-08-9) is a chemical compound with the molecular formula C14H28N2O3 and a molecular weight of 272.38 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(diethylamino)-3-methyl-1-oxobutan-2-yl]carbamate. InChIKey: KSTYPCOKXZWLER-NSHDSACASA-N.
| Molecular formula | C14H28N2O3 |
|---|---|
| Molecular weight | 272.38 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(diethylamino)-3-methyl-1-oxobutan-2-yl]carbamate |
| InChIKey | KSTYPCOKXZWLER-NSHDSACASA-N |
| SMILES | CCN(CC)C(=O)[C@H](C(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)