cas: 57597-64-5 — see every product listed under this CAS number, including other names
7-(Diethylamino)-2-oxo-2H-chromene-3-carbaldehyde, 98%, 98% (CAS 57597-64-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148KW-100mg |
| cas | 57597-64-5 |
| size | 100mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1720.40 Pln | |
| Chemat | 10g | 3309.20 Pln | |
| Chemat | 15g | 4782.80 Pln | |
| Chemat | 25g | 7178.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-(diethylamino)-2-oxochromene-3-carbaldehyde (CAS 57597-64-5) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 7-(diethylamino)-2-oxochromene-3-carbaldehyde. InChIKey: HWQSZPUCHJKWLS-UHFFFAOYSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 7-(diethylamino)-2-oxochromene-3-carbaldehyde |
| InChIKey | HWQSZPUCHJKWLS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C=O |
Computed by PubChem (NCBI)