Products 844860-72-6

CAS 844860-72-6 is the registry number for 1-(2-Methoxyphenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid (CAS 844860-72-6) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 1-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid. InChIKey: RZQWEQFMIYFBCO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15NO3
Molecular weight245.27 g/mol
IUPAC name1-(2-methoxyphenyl)-2,5-dimethylpyrrole-3-carboxylic acid
InChIKeyRZQWEQFMIYFBCO-UHFFFAOYSA-N
SMILESCC1=CC(=C(N1C2=CC=CC=C2OC)C)C(=O)O

Computed by PubChem (NCBI)