cas: 1101857-21-9 — see every product listed under this CAS number, including other names
7-(Tert-Butyl) 3-Ethyl 2-Amino-5,6-Dihydrothieno[2,3-B]Pyridine-3,7(4H)-Dicarboxylate, 97%, 97% (CAS 1101857-21-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL6R-100mg |
| cas | 1101857-21-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate (CAS 1101857-21-9) is a chemical compound with the molecular formula C15H22N2O4S and a molecular weight of 326.4 g/mol. IUPAC name: 7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate. InChIKey: WBVQCUDNEXXBAC-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4S |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 7-O-tert-butyl 3-O-ethyl 2-amino-5,6-dihydro-4H-thieno[2,3-b]pyridine-3,7-dicarboxylate |
| InChIKey | WBVQCUDNEXXBAC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC2=C1CCCN2C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)