cas: 1365759-12-1 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)-3,4-dihydroisoquinolin-1(2H)-one 97% (CAS 1365759-12-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A128621-100mg |
| cas | 1365759-12-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 726.38 Pln | |
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 2189.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A128621 |
7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one (CAS 1365759-12-1) is a chemical compound with the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. IUPAC name: 7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: PWZSJDNHPNHZMD-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO |
|---|---|
| Molecular weight | 215.17 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | PWZSJDNHPNHZMD-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)