cas: 920980-60-5 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)benzo[d]thiazole-2(3H)-thione, 95% (CAS 920980-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11780K-100mg |
| cas | 920980-60-5 |
| size | 100mg |
| availability | 20g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 491.60 Pln | |
| Chemat | 10g | 774.80 Pln | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 653.95 Pln | |
| Fluorochem | 10g | 1023.62 Pln | |
| Fluorochem | 25g | 2012.85 Pln | |
| Fluorochem | 100g | 5199.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-(trifluoromethyl)-3H-1,3-benzothiazole-2-thione (CAS 920980-60-5) is a chemical compound with the molecular formula C8H4F3NS2 and a molecular weight of 235.3 g/mol. IUPAC name: 7-(trifluoromethyl)-3H-1,3-benzothiazole-2-thione. InChIKey: RGOGQRBKTBEDBX-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NS2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 7-(trifluoromethyl)-3H-1,3-benzothiazole-2-thione |
| InChIKey | RGOGQRBKTBEDBX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=S)S2)C(F)(F)F |
Computed by PubChem (NCBI)