cas: 410086-28-1 — see every product listed under this CAS number, including other names
7-(Trifluoromethyl)isoquinolin-1(2H)-one, 97% (CAS 410086-28-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A421452-10g |
| cas | 410086-28-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 33440.26 Pln | |
| AmBeed | 5g | 20094.76 Pln | |
| Fluorochem | 100mg | 1549.47 Pln | |
| Fluorochem | 250mg | 2528.29 Pln | |
| Fluorochem | 1g | 6219.70 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-(trifluoromethyl)-2H-isoquinolin-1-one (CAS 410086-28-1) is a chemical compound with the molecular formula C10H6F3NO and a molecular weight of 213.16 g/mol. IUPAC name: 7-(trifluoromethyl)-2H-isoquinolin-1-one. InChIKey: BTXOPRIQIDKOLM-UHFFFAOYSA-N.
| Molecular formula | C10H6F3NO |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 7-(trifluoromethyl)-2H-isoquinolin-1-one |
| InChIKey | BTXOPRIQIDKOLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CNC2=O)C(F)(F)F |
Computed by PubChem (NCBI)