cas: 885281-30-1 — see every product listed under this CAS number, including other names
7-BOC-5,6-DIHYDRO-8H-IMIDAZO[1,2-A]PYRAZINE-2-CARBOXYLIC ACID, 96% (CAS 885281-30-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300780-250MG |
| cas | 885281-30-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 768.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid (CAS 885281-30-1) is a chemical compound with the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid. InChIKey: YUBMPMRXTOOBIU-UHFFFAOYSA-N.
| Molecular formula | C12H17N3O4 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxylic acid |
| InChIKey | YUBMPMRXTOOBIU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C=C(N=C2C1)C(=O)O |
Computed by PubChem (NCBI)