7-Benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione, 98%
cas: 28863-87-8 — see every product listed under this CAS number, including other names
7-Benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione, 98% (CAS 28863-87-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A291022-100mg |
| cas | 28863-87-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 548.38 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 500mg | 472.40 Pln | |
| Chemat | 1g | 832.40 Pln | |
| BLDpharm | 100mg | 186.63 Pln | |
| BLDpharm | 250mg | 264.38 Pln | |
| BLDpharm | 1g | 580.93 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
7-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione (CAS 28863-87-8) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 7-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione. InChIKey: RZHBDUGHJGKVFY-UHFFFAOYSA-N.
| Molecular formula | C13H15N3O2 |
|---|---|
| Molecular weight | 245.28 g/mol |
| IUPAC name | 7-benzyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| InChIKey | RZHBDUGHJGKVFY-UHFFFAOYSA-N |
| SMILES | C1CN(CC12C(=O)NC(=O)N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)