Products 824431-10-9

CAS 824431-10-9 is the registry number for 4-(((3,5-Dimethyl-1h-pyrazol-1-yl)methyl)amino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

4-[(3,5-dimethylpyrazol-1-yl)methylamino]benzoic acid (CAS 824431-10-9) is a chemical compound with the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. IUPAC name: 4-[(3,5-dimethylpyrazol-1-yl)methylamino]benzoic acid. InChIKey: CNKABRURYDJZAR-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15N3O2
Molecular weight245.28 g/mol
IUPAC name4-[(3,5-dimethylpyrazol-1-yl)methylamino]benzoic acid
InChIKeyCNKABRURYDJZAR-UHFFFAOYSA-N
SMILESCC1=CC(=NN1CNC2=CC=C(C=C2)C(=O)O)C

Computed by PubChem (NCBI)