cas: 1374258-30-6 — see every product listed under this CAS number, including other names
7-Bromo-1-methoxyisoquinoline, 98%, 98% (CAS 1374258-30-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12OZ9N-10g |
| cas | 1374258-30-6 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 3472.40 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 352.40 Pln | |
| Chemat | 1g | 645.20 Pln | |
| Chemat | 5g | 2104.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-1-methoxyisoquinoline (CAS 1374258-30-6) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 7-bromo-1-methoxyisoquinoline. InChIKey: RNZQCNYQATWREI-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 7-bromo-1-methoxyisoquinoline |
| InChIKey | RNZQCNYQATWREI-UHFFFAOYSA-N |
| SMILES | COC1=NC=CC2=C1C=C(C=C2)Br |
Computed by PubChem (NCBI)