cas: 114417-34-4 — see every product listed under this CAS number, including other names
7-Bromo-2,3-dihydroquinolin-4(1H)-one 98% (CAS 114417-34-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A406658-100mg |
| cas | 114417-34-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 548.38 Pln | |
| Ambeed | 1g | 1277.06 Pln | |
| Ambeed | 5g | 4703.56 Pln | |
| Ambeed | 10g | 7240.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A406658 |
7-bromo-2,3-dihydro-1H-quinolin-4-one (CAS 114417-34-4) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1H-quinolin-4-one. InChIKey: MZRDGUADMZHLRW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1H-quinolin-4-one |
| InChIKey | MZRDGUADMZHLRW-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)