cas: 114417-34-4 — see every product listed under this CAS number, including other names
7-Bromo-2,3-dihydroquinolin-4(1H)-one, 98%, 98% (CAS 114417-34-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111BA0-10g |
| cas | 114417-34-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 6146.00 Pln | |
| Chemat | 100mg | 294.80 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 3635.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromo-2,3-dihydro-1H-quinolin-4-one (CAS 114417-34-4) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1H-quinolin-4-one. InChIKey: MZRDGUADMZHLRW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1H-quinolin-4-one |
| InChIKey | MZRDGUADMZHLRW-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=CC(=C2)Br |
Computed by PubChem (NCBI)