7-Bromo-2,4,6-trichloroquinazoline, 97%
cas: 1956389-96-0 — see every product listed under this CAS number, including other names
7-Bromo-2,4,6-trichloroquinazoline, 97% (CAS 1956389-96-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A125820-100mg |
| cas | 1956389-96-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 565.06 Pln | |
| Ambeed | 5g | 2211.56 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 429.20 Pln | |
| BLDpharm | 100mg | 164.41 Pln | |
| BLDpharm | 250mg | 308.80 Pln | |
| BLDpharm | 1g | 608.70 Pln | |
| BLDpharm | 5g | 2380.30 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 5g | 2622.01 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-bromo-2,4,6-trichloroquinazoline (CAS 1956389-96-0) is a chemical compound with the molecular formula C8H2BrCl3N2 and a molecular weight of 312.4 g/mol. IUPAC name: 7-bromo-2,4,6-trichloroquinazoline. InChIKey: GDQRQHIERHLVDA-UHFFFAOYSA-N.
| Molecular formula | C8H2BrCl3N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 7-bromo-2,4,6-trichloroquinazoline |
| InChIKey | GDQRQHIERHLVDA-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Br)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)