CAS 2771459-83-5 is the registry number for 7-Bromo-2,4,8-trichloroquinazoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,4,8-trichloroquinazoline (CAS 2771459-83-5) is a chemical compound with the molecular formula C8H2BrCl3N2 and a molecular weight of 312.4 g/mol. IUPAC name: 7-bromo-2,4,8-trichloroquinazoline. InChIKey: ZEHBTASLZKBUPR-UHFFFAOYSA-N.
| Molecular formula | C8H2BrCl3N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 7-bromo-2,4,8-trichloroquinazoline |
| InChIKey | ZEHBTASLZKBUPR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=NC(=N2)Cl)Cl)Cl)Br |
Computed by PubChem (NCBI)