7-Bromo-5-chloro-3-iodo-1H-indazole, 95%
cas: 2385755-01-9 — see every product listed under this CAS number, including other names
7-Bromo-5-chloro-3-iodo-1H-indazole, 95% (CAS 2385755-01-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A451330-250mg |
| cas | 2385755-01-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 943.31 Pln | |
| Ambeed | 1g | 2528.62 Pln | |
| BLDpharm | 100mg | 575.38 Pln | |
| BLDpharm | 250mg | 925.25 Pln | |
| BLDpharm | 1g | 2480.26 Pln | |
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1274.00 Pln | |
| Fluorochem | 100mg | 607.10 Pln | |
| Fluorochem | 250mg | 966.34 Pln | |
| Fluorochem | 1g | 2606.39 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
7-bromo-5-chloro-3-iodo-2H-indazole (CAS 2385755-01-9) is a chemical compound with the molecular formula C7H3BrClIN2 and a molecular weight of 357.37 g/mol. IUPAC name: 7-bromo-5-chloro-3-iodo-2H-indazole. InChIKey: RRZWVBOYVIEETP-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClIN2 |
|---|---|
| Molecular weight | 357.37 g/mol |
| IUPAC name | 7-bromo-5-chloro-3-iodo-2H-indazole |
| InChIKey | RRZWVBOYVIEETP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=NNC(=C21)I)Br)Cl |
Computed by PubChem (NCBI)