cas: 7640-33-7 — see every product listed under this CAS number, including other names
7-Bromo-5-chloroquinolin-8-ol 98% (CAS 7640-33-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A635486-250mg |
| cas | 7640-33-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 398.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A635486 |
7-bromo-5-chloroquinolin-8-ol (CAS 7640-33-7) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 7-bromo-5-chloroquinolin-8-ol. InChIKey: ADJQQSUBKRASQN-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 7-bromo-5-chloroquinolin-8-ol |
| InChIKey | ADJQQSUBKRASQN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2Cl)Br)O)N=C1 |
Computed by PubChem (NCBI)