cas: 957120-89-7 — see every product listed under this CAS number, including other names
7-Bromoindole-2-boronic acid, 98%, 98% (CAS 957120-89-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116YD9-250mg |
| cas | 957120-89-7 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln | |
| Chemat | 5g | 2661.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(7-bromo-1H-indol-2-yl)boronic acid (CAS 957120-89-7) is a chemical compound with the molecular formula C8H7BBrNO2 and a molecular weight of 239.86 g/mol. IUPAC name: (7-bromo-1H-indol-2-yl)boronic acid. InChIKey: KLQBMECATXATSZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BBrNO2 |
|---|---|
| Molecular weight | 239.86 g/mol |
| IUPAC name | (7-bromo-1H-indol-2-yl)boronic acid |
| InChIKey | KLQBMECATXATSZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1)C(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)