CAS 957120-89-7 appears in our catalog under these names: 7-Bromoindole-2-boronic acid, 98%, 7-Bromoindole-2-boronic acid, 98%, 98%, (7-Bromo-1H-indol-2-yl)boronic acid 98%, (7-Bromo-1H-indol-2-yl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(7-bromo-1H-indol-2-yl)boronic acid (CAS 957120-89-7) is a chemical compound with the molecular formula C8H7BBrNO2 and a molecular weight of 239.86 g/mol. IUPAC name: (7-bromo-1H-indol-2-yl)boronic acid. InChIKey: KLQBMECATXATSZ-UHFFFAOYSA-N.
| Molecular formula | C8H7BBrNO2 |
|---|---|
| Molecular weight | 239.86 g/mol |
| IUPAC name | (7-bromo-1H-indol-2-yl)boronic acid |
| InChIKey | KLQBMECATXATSZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1)C(=CC=C2)Br)(O)O |
Computed by PubChem (NCBI)