cas: 52333-42-3 — see every product listed under this CAS number, including other names
7-Bromopyrido[2,3-b]pyrazine, 97%, 97% (CAS 52333-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117UTM-100mg |
| cas | 52333-42-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 500mg | 179.60 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 616.40 Pln | |
| Chemat | 10g | 1067.60 Pln | |
| Chemat | 25g | 1874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
7-bromopyrido[2,3-b]pyrazine (CAS 52333-42-3) is a chemical compound with the molecular formula C7H4BrN3 and a molecular weight of 210.03 g/mol. IUPAC name: 7-bromopyrido[2,3-b]pyrazine. InChIKey: YEDMUIQRKXNDQI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3 |
|---|---|
| Molecular weight | 210.03 g/mol |
| IUPAC name | 7-bromopyrido[2,3-b]pyrazine |
| InChIKey | YEDMUIQRKXNDQI-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(C=N2)Br |
Computed by PubChem (NCBI)