cas: 52333-42-3 — see every product listed under this CAS number, including other names
7-Bromopyrido[2,3-b]pyrazine, 97% (CAS 52333-42-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046314-1G |
| cas | 52333-42-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 669.57 Pln | |
| Fluorochem | 10g | 1252.70 Pln | |
| Fluorochem | 25g | 2543.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
7-bromopyrido[2,3-b]pyrazine (CAS 52333-42-3) is a chemical compound with the molecular formula C7H4BrN3 and a molecular weight of 210.03 g/mol. IUPAC name: 7-bromopyrido[2,3-b]pyrazine. InChIKey: YEDMUIQRKXNDQI-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3 |
|---|---|
| Molecular weight | 210.03 g/mol |
| IUPAC name | 7-bromopyrido[2,3-b]pyrazine |
| InChIKey | YEDMUIQRKXNDQI-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=N1)C=C(C=N2)Br |
Computed by PubChem (NCBI)