cas: 1318133-32-2 — see every product listed under this CAS number, including other names
7-Bromothieno[3,2-d]pyrimidin-4-amine, 98%, 98% (CAS 1318133-32-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZRU-250mg |
| cas | 1318133-32-2 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1494.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-bromothieno[3,2-d]pyrimidin-4-amine (CAS 1318133-32-2) is a chemical compound with the molecular formula C6H4BrN3S and a molecular weight of 230.09 g/mol. IUPAC name: 7-bromothieno[3,2-d]pyrimidin-4-amine. InChIKey: HOIZVIAMXIFSDA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 7-bromothieno[3,2-d]pyrimidin-4-amine |
| InChIKey | HOIZVIAMXIFSDA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)