CAS 1318133-32-2 appears in our catalog under these names: 7-Bromothieno[3,2-d]pyrimidin-4-amine, 95%, 7-Bromothieno(3,2-d)pyrimidin-4-amine, 7-Bromothieno[3,2-d]pyrimidin-4-amine 98%, 7-Bromothieno[3,2-d]pyrimidin-4-amine, 98%, 98%, 7-Bromothieno[3,2-d]pyrimidin-4-amine, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 0,5g.
7-bromothieno[3,2-d]pyrimidin-4-amine (CAS 1318133-32-2) is a chemical compound with the molecular formula C6H4BrN3S and a molecular weight of 230.09 g/mol. IUPAC name: 7-bromothieno[3,2-d]pyrimidin-4-amine. InChIKey: HOIZVIAMXIFSDA-UHFFFAOYSA-N.
| Molecular formula | C6H4BrN3S |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 7-bromothieno[3,2-d]pyrimidin-4-amine |
| InChIKey | HOIZVIAMXIFSDA-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)N)Br |
Computed by PubChem (NCBI)