cas: 41102-02-7 — see every product listed under this CAS number, including other names
7-Bromothieno[3,2-d]pyrimidine-2,4(1H,3H)-dione 98% (CAS 41102-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A984478-100mg |
| cas | 41102-02-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 882.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A984478 |
7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 41102-02-7) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: XTTGKZVCJRAADD-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | XTTGKZVCJRAADD-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=O)NC(=O)N2)Br |
Computed by PubChem (NCBI)