cas: 41102-02-7 — see every product listed under this CAS number, including other names
7-bromo-1H,2H,3H,4H-thieno[3,2-d]pyrimidine-2,4-dione, 97% (CAS 41102-02-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F818510-250MG |
| cas | 41102-02-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 383.22 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 3855.95 Pln | |
| Fluorochem | 10g | 5673.02 Pln | |
| Fluorochem | 25g | 12118.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione (CAS 41102-02-7) is a chemical compound with the molecular formula C6H3BrN2O2S and a molecular weight of 247.07 g/mol. IUPAC name: 7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione. InChIKey: XTTGKZVCJRAADD-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN2O2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | 7-bromo-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| InChIKey | XTTGKZVCJRAADD-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=O)NC(=O)N2)Br |
Computed by PubChem (NCBI)