cas: 18735-81-4 — see every product listed under this CAS number, including other names
7-Chloro-4-hydroxy-2H-chromen-2-one, ≥97%, ≥97% (CAS 18735-81-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DF2T-1g |
| cas | 18735-81-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 6611.60 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
7-chloro-4-hydroxychromen-2-one (CAS 18735-81-4) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 7-chloro-4-hydroxychromen-2-one. InChIKey: PKVBFOLFCIJRRE-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 7-chloro-4-hydroxychromen-2-one |
| InChIKey | PKVBFOLFCIJRRE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=O)C=C2O |
Computed by PubChem (NCBI)