CAS 442125-04-4 appears in our catalog under these names: 6-Chlorobenzofuran-2-carboxylic acid, 95%, 6-Chloro-1-benzofuran-2-carboxylic Acid, >95% (HPLC), 6-Chlorobenzofuran-2-carboxylic acid, 97%, 97%, 6-Clorobenzofuran-2-carboxylic acid, 95%, 6-Chloro-1-benzofuran-2-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 2.5g.
6-chloro-1-benzofuran-2-carboxylic acid (CAS 442125-04-4) is a chemical compound with the molecular formula C9H5ClO3 and a molecular weight of 196.58 g/mol. IUPAC name: 6-chloro-1-benzofuran-2-carboxylic acid. InChIKey: PWSOSTMTCRJPDX-UHFFFAOYSA-N.
| Molecular formula | C9H5ClO3 |
|---|---|
| Molecular weight | 196.58 g/mol |
| IUPAC name | 6-chloro-1-benzofuran-2-carboxylic acid |
| InChIKey | PWSOSTMTCRJPDX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)