cas: 15345-55-8 — see every product listed under this CAS number, including other names
7-Chloro-4-methoxyindoline-2,3-dione, >97%, >97% (CAS 15345-55-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J8QB-100mg |
| cas | 15345-55-8 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1038.80 Pln | |
| Chemat | 5g | 3174.80 Pln | |
| Chemat | 10g | 5843.60 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
7-chloro-4-methoxy-1H-indole-2,3-dione (CAS 15345-55-8) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 7-chloro-4-methoxy-1H-indole-2,3-dione. InChIKey: DVVWQQZWRTXTMK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 7-chloro-4-methoxy-1H-indole-2,3-dione |
| InChIKey | DVVWQQZWRTXTMK-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)Cl)NC(=O)C2=O |
Computed by PubChem (NCBI)