CAS 1156390-49-6 appears in our catalog under these names: 6-Chloro-2-oxo-2,3-dihydro-1H-indole-5-carboxylic acid, 96%, 6-Chloro-2,3-dihydro-2-oxo-1H-indole-5-carboxylic Acid, 6-Chloro-2-oxo-2,3-dihydro-1H-indole-5-carboxylic acid, 6-Chloro-2-oxoindoline-5-carboxylic acid 97%, 6-Chloro-2-oxoindoline-5-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 0,5g, 50mg.
6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid (CAS 1156390-49-6) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid. InChIKey: GALGGHJFGWMWCN-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 6-chloro-2-oxo-1,3-dihydroindole-5-carboxylic acid |
| InChIKey | GALGGHJFGWMWCN-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)C(=O)O |
Computed by PubChem (NCBI)