cas: 80416-76-8 — see every product listed under this CAS number, including other names
7-Chlorobenzo[d]thiazol-2(3H)-one, 95%, 95% (CAS 80416-76-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G61G-100mg |
| cas | 80416-76-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 386.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-chloro-3H-1,3-benzothiazol-2-one (CAS 80416-76-8) is a chemical compound with the molecular formula C7H4ClNOS and a molecular weight of 185.63 g/mol. IUPAC name: 7-chloro-3H-1,3-benzothiazol-2-one. InChIKey: MLYFRFPTIGFBDU-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNOS |
|---|---|
| Molecular weight | 185.63 g/mol |
| IUPAC name | 7-chloro-3H-1,3-benzothiazol-2-one |
| InChIKey | MLYFRFPTIGFBDU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=O)N2 |
Computed by PubChem (NCBI)