cas: 2776103-53-6 — see every product listed under this CAS number, including other names
7-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 97% (CAS 2776103-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F787526-100MG |
| cas | 2776103-53-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1861.86 Pln | |
| Fluorochem | 250mg | 3127.04 Pln | |
| Fluorochem | 1g | 8328.34 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2776103-53-6) is a chemical compound with the molecular formula C15H17BFNO2 and a molecular weight of 273.11 g/mol. IUPAC name: 7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: ZGEDBGYOJMADIC-UHFFFAOYSA-N.
| Molecular formula | C15H17BFNO2 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | 7-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | ZGEDBGYOJMADIC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2F)N=CC=C3 |
Computed by PubChem (NCBI)