CAS 1251731-31-3 is the registry number for 6-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 95+%. Offered by: Ambeed. Available pack sizes: 250mg, 100mg, 5g, 1g.
6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 1251731-31-3) is a chemical compound with the molecular formula C15H17BFNO2 and a molecular weight of 273.11 g/mol. IUPAC name: 6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: VCMDSNXJEYGKFP-UHFFFAOYSA-N.
| Molecular formula | C15H17BFNO2 |
|---|---|
| Molecular weight | 273.11 g/mol |
| IUPAC name | 6-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | VCMDSNXJEYGKFP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CC(=C3)F)N=C2 |
Computed by PubChem (NCBI)