cas: 912846-66-3 — see every product listed under this CAS number, including other names
7-Fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride 95% (CAS 912846-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A310098-100mg |
| cas | 912846-66-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 225.75 Pln | |
| Ambeed | 250mg | 420.44 Pln | |
| Ambeed | 1g | 1037.88 Pln | |
| Ambeed | 5g | 2906.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A310098 |
7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 912846-66-3) is a chemical compound with the molecular formula C9H10ClFN2O2 and a molecular weight of 232.64 g/mol. IUPAC name: 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: LIDVFTHPRDVIOK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2O2 |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | LIDVFTHPRDVIOK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)[N+](=O)[O-])F.Cl |
Computed by PubChem (NCBI)