cas: 912846-66-3 — see every product listed under this CAS number, including other names
7-Fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 96% (CAS 912846-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F325287-100MG |
| cas | 912846-66-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 357.18 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 912846-66-3) is a chemical compound with the molecular formula C9H10ClFN2O2 and a molecular weight of 232.64 g/mol. IUPAC name: 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: LIDVFTHPRDVIOK-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFN2O2 |
|---|---|
| Molecular weight | 232.64 g/mol |
| IUPAC name | 7-fluoro-6-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | LIDVFTHPRDVIOK-UHFFFAOYSA-N |
| SMILES | C1CNCC2=CC(=C(C=C21)[N+](=O)[O-])F.Cl |
Computed by PubChem (NCBI)