cas: 509147-83-5 — see every product listed under this CAS number, including other names
7-Fluorobenzo(d)oxazol-2(3H)-one, 97% (CAS 509147-83-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A888243-5g |
| cas | 509147-83-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6918.52 Pln | |
| AmBeed | 10g | 8838.97 Pln | |
| AmBeed | 100mg | 519.19 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-fluoro-3H-1,3-benzoxazol-2-one (CAS 509147-83-5) is a chemical compound with the molecular formula C7H4FNO2 and a molecular weight of 153.11 g/mol. IUPAC name: 7-fluoro-3H-1,3-benzoxazol-2-one. InChIKey: CHWRMLDDKQDGEP-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO2 |
|---|---|
| Molecular weight | 153.11 g/mol |
| IUPAC name | 7-fluoro-3H-1,3-benzoxazol-2-one |
| InChIKey | CHWRMLDDKQDGEP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(=O)N2 |
Computed by PubChem (NCBI)