cas: 509147-83-5 — see every product listed under this CAS number, including other names
7-Fluorobenzo[d]oxazol-2(3H)-one, 97% (CAS 509147-83-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F605533-100MG |
| cas | 509147-83-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 1g | 1080.89 Pln | |
| Fluorochem | 5g | 4319.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
7-fluoro-3H-1,3-benzoxazol-2-one (CAS 509147-83-5) is a chemical compound with the molecular formula C7H4FNO2 and a molecular weight of 153.11 g/mol. IUPAC name: 7-fluoro-3H-1,3-benzoxazol-2-one. InChIKey: CHWRMLDDKQDGEP-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO2 |
|---|---|
| Molecular weight | 153.11 g/mol |
| IUPAC name | 7-fluoro-3H-1,3-benzoxazol-2-one |
| InChIKey | CHWRMLDDKQDGEP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)OC(=O)N2 |
Computed by PubChem (NCBI)