cas: 550998-67-9 — see every product listed under this CAS number, including other names
7-Fluorobenzo[b]thiophene-2-carboxylic acid, 98%, 98% (CAS 550998-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCMC-100mg |
| cas | 550998-67-9 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 990.80 Pln | |
| Chemat | 25g | 3309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-1-benzothiophene-2-carboxylic acid (CAS 550998-67-9) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 7-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: SIZCXIFQEFCFIU-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 7-fluoro-1-benzothiophene-2-carboxylic acid |
| InChIKey | SIZCXIFQEFCFIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)