7-Fluorobenzo[b]thiophene-2-carboxylic acid, 98%
cas: 550998-67-9 — see every product listed under this CAS number, including other names
7-Fluorobenzo[b]thiophene-2-carboxylic acid, 98% (CAS 550998-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCMC-100mg |
| cas | 550998-67-9 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 856.40 Pln | |
| Chemat | 25g | 3938.00 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 362.39 Pln | |
| Fluorochem | 5g | 992.38 Pln | |
| Fluorochem | 10g | 1903.51 Pln | |
| Fluorochem | 25g | 3475.88 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-fluoro-1-benzothiophene-2-carboxylic acid (CAS 550998-67-9) is a chemical compound with the molecular formula C9H5FO2S and a molecular weight of 196.20 g/mol. IUPAC name: 7-fluoro-1-benzothiophene-2-carboxylic acid. InChIKey: SIZCXIFQEFCFIU-UHFFFAOYSA-N.
| Molecular formula | C9H5FO2S |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 7-fluoro-1-benzothiophene-2-carboxylic acid |
| InChIKey | SIZCXIFQEFCFIU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)F)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)