cas: 84806-27-9 — see every product listed under this CAS number, including other names
7-Fluorobenzofurazan-4-sulfonic acid ammonium, 97% (CAS 84806-27-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A578742-1g |
| cas | 84806-27-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 12172.09 Pln | |
| AmBeed | 250mg | 4893.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid (CAS 84806-27-9) is a chemical compound with the molecular formula C6H6FN3O4S and a molecular weight of 235.20 g/mol. IUPAC name: azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid. InChIKey: JXLHNMVSKXFWAO-UHFFFAOYSA-N.
| Molecular formula | C6H6FN3O4S |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid |
| InChIKey | JXLHNMVSKXFWAO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)S(=O)(=O)O)F.N |
Computed by PubChem (NCBI)