cas: 84806-27-9 — see every product listed under this CAS number, including other names
Ammonium 7-fluorobenzo[c][1,2,5]oxadiazole-4-sulfonate, 98%, 98% (CAS 84806-27-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 5mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114NFB-10mg |
| cas | 84806-27-9 |
| size | 10mg |
| availability | 0.03g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 5mg | 328.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid (CAS 84806-27-9) is a chemical compound with the molecular formula C6H6FN3O4S and a molecular weight of 235.20 g/mol. IUPAC name: azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid. InChIKey: JXLHNMVSKXFWAO-UHFFFAOYSA-N.
| Molecular formula | C6H6FN3O4S |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid |
| InChIKey | JXLHNMVSKXFWAO-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)S(=O)(=O)O)F.N |
Computed by PubChem (NCBI)