cas: 1251014-84-2 — see every product listed under this CAS number, including other names
7-Hydroxymethyl-7,8-Dihydro-4H,6H-1,5,8A-Triaza-Azulene-5-Carboxylic Acid Tert-Butyl Ester, 97%, 97% (CAS 1251014-84-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HI33-100mg |
| cas | 1251014-84-2 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2229.20 Pln | |
| Chemat | 250mg | 2954.00 Pln | |
| Chemat | 500mg | 4878.80 Pln | |
| Chemat | 1g | 7288.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 7-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate (CAS 1251014-84-2) is a chemical compound with the molecular formula C13H21N3O3 and a molecular weight of 267.32 g/mol. IUPAC name: tert-butyl 7-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate. InChIKey: KAKGPQPJSNUNBV-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O3 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | tert-butyl 7-(hydroxymethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepine-5-carboxylate |
| InChIKey | KAKGPQPJSNUNBV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CN2C(=CC=N2)C1)CO |
Computed by PubChem (NCBI)