CAS 1251000-23-3 is the registry number for tert-Butyl 3-hydroxy-6,6-dimethyl-6,7-dihydro-1h-pyrazolo[4,3-b]pyridine-4(5h)-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl 6,6-dimethyl-3-oxo-1,2,5,7-tetrahydropyrazolo[4,3-b]pyridine-4-carboxylate (CAS 1251000-23-3) is a chemical compound with the molecular formula C13H21N3O3 and a molecular weight of 267.32 g/mol. IUPAC name: tert-butyl 6,6-dimethyl-3-oxo-1,2,5,7-tetrahydropyrazolo[4,3-b]pyridine-4-carboxylate. InChIKey: ZFDPXTPNDZHDAE-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O3 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | tert-butyl 6,6-dimethyl-3-oxo-1,2,5,7-tetrahydropyrazolo[4,3-b]pyridine-4-carboxylate |
| InChIKey | ZFDPXTPNDZHDAE-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)NN2)N(C1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)