cas: 114748-67-3 — see every product listed under this CAS number, including other names
7-Iodo-7-deaza-dideoxyguanosine, 98%, 98% (CAS 114748-67-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111F6O-100mg |
| cas | 114748-67-3 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 3467.60 Pln | |
| Chemat | 250mg | 6026.00 Pln | |
| Chemat | 1g | 12477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one (CAS 114748-67-3) is a chemical compound with the molecular formula C11H13IN4O3 and a molecular weight of 376.15 g/mol. IUPAC name: 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one. InChIKey: KJNOBXXCZQLWLF-CAHLUQPWSA-N.
| Molecular formula | C11H13IN4O3 |
|---|---|
| Molecular weight | 376.15 g/mol |
| IUPAC name | 2-amino-7-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-5-iodo-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| InChIKey | KJNOBXXCZQLWLF-CAHLUQPWSA-N |
| SMILES | C1C[C@@H](O[C@@H]1CO)N2C=C(C3=C2N=C(NC3=O)N)I |
Computed by PubChem (NCBI)